C21H33FN4O2 — CID 109383594
3-ethyl-2-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109383594) has the molecular formula C21H33FN4O2 and a molecular weight of 392.52 g/mol. Its IUPAC name is 3-ethyl-2-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 3-ethyl-2-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109383594 |
| Molecular Formula | C21H33FN4O2 |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 3-ethyl-2-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\CC(c1cccc(F)c1)N1CCOCC1)N(C)CC1CCOC1 |
| InChI | InChI=1S/C21H33FN4O2/c1-3-23-21(25(2)15-17-7-10-28-16-17)24-14-20(26-8-11-27-12-9-26)18-5-4-6-19(22)13-18/h4-6,13,17,20H,3,7-12,14-16H2,1-2H3,(H,23,24) |
| InChIKey | SLFHHLMNEBFNTB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|