C24H34N4OS — CID 109386929
2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109386929) has the molecular formula C24H34N4OS and a molecular weight of 426.63 g/mol. Its IUPAC name is 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109386929 |
| Molecular Formula | C24H34N4OS |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\CC(c1ccccc1)N1CCc2sccc2C1)N(C)CC1CCOC1 |
| InChI | InChI=1S/C24H34N4OS/c1-3-25-24(27(2)16-19-10-13-29-18-19)26-15-22(20-7-5-4-6-8-20)28-12-9-23-21(17-28)11-14-30-23/h4-8,11,14,19,22H,3,9-10,12-13,15-18H2,1-2H3,(H,25,26) |
| InChIKey | BTWVIWTUMKSAEZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|