C24H34N4OS — CID 111189204
2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine (PubChem CID 111189204) has the molecular formula C24H34N4OS and a molecular weight of 426.63 g/mol. Its IUPAC name is 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine.
| Compound Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine |
|---|---|
| PubChem CID | 111189204 |
| Molecular Formula | C24H34N4OS |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine |
| SMILES | CCN/C(=N\CC(c1ccccc1)N1CCc2sccc2C1)NC1CCC(O)CC1 |
| InChI | InChI=1S/C24H34N4OS/c1-2-25-24(27-20-8-10-21(29)11-9-20)26-16-22(18-6-4-3-5-7-18)28-14-12-23-19(17-28)13-15-30-23/h3-7,13,15,20-22,29H,2,8-12,14,16-17H2,1H3,(H2,25,26,27) |
| InChIKey | BAUNWDLSQBPTJQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|