C20H28N4S — CID 111125925
1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]-2-methyl-3-propan-2-ylguanidine (PubChem CID 111125925) has the molecular formula C20H28N4S and a molecular weight of 356.54 g/mol. Its IUPAC name is 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]-2-methyl-3-propan-2-ylguanidine.
| Compound Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]-2-methyl-3-propan-2-ylguanidine |
|---|---|
| PubChem CID | 111125925 |
| Molecular Formula | C20H28N4S |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]-2-methyl-3-propan-2-ylguanidine |
| SMILES | C/N=C(/NCC(c1ccccc1)N1CCc2sccc2C1)NC(C)C |
| InChI | InChI=1S/C20H28N4S/c1-15(2)23-20(21-3)22-13-18(16-7-5-4-6-8-16)24-11-9-19-17(14-24)10-12-25-19/h4-8,10,12,15,18H,9,11,13-14H2,1-3H3,(H2,21,22,23) |
| InChIKey | VGOAVYPCPPJHNF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|