C24H33IN6S — CID 111952520
1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111952520) has the molecular formula C24H33IN6S and a molecular weight of 564.54 g/mol. Its IUPAC name is 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111952520 |
| Molecular Formula | C24H33IN6S |
| Molecular Weight | 564.54 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1c(C)nn(C)c1C)NCC(c1ccccc1)N1CCc2sccc2C1.I |
| InChI | InChI=1S/C24H32N6S.HI/c1-17-21(18(2)29(4)28-17)14-26-24(25-3)27-15-22(19-8-6-5-7-9-19)30-12-10-23-20(16-30)11-13-31-23;/h5-9,11,13,22H,10,12,14-16H2,1-4H3,(H2,25,26,27);1H |
| InChIKey | JPWKNDJCTAXZFI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|