C17H25IN4S2 — CID 111258270
1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111258270) has the molecular formula C17H25IN4S2 and a molecular weight of 476.45 g/mol. Its IUPAC name is 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111258270 |
| Molecular Formula | C17H25IN4S2 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cccs1)NCC(C)N1CCc2sccc2C1.I |
| InChI | InChI=1S/C17H24N4S2.HI/c1-13(21-7-5-16-14(12-21)6-9-23-16)10-19-17(18-2)20-11-15-4-3-8-22-15;/h3-4,6,8-9,13H,5,7,10-12H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | JQNHBMTUUDVVEC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|