C21H37N5OS — CID 111930866
1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine (PubChem CID 111930866) has the molecular formula C21H37N5OS and a molecular weight of 407.63 g/mol. Its IUPAC name is 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine.
| Compound Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine |
|---|---|
| PubChem CID | 111930866 |
| Molecular Formula | C21H37N5OS |
| Molecular Weight | 407.63 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine |
| SMILES | C/N=C(/NCC(C)N1CCc2sccc2C1)NCC(C(C)C)N1CCOCC1 |
| InChI | InChI=1S/C21H37N5OS/c1-16(2)19(25-8-10-27-11-9-25)14-24-21(22-4)23-13-17(3)26-7-5-20-18(15-26)6-12-28-20/h6,12,16-17,19H,5,7-11,13-15H2,1-4H3,(H2,22,23,24) |
| InChIKey | FEBOBHPYLCFACY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.63 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|