C15H26N4S — CID 111126538
1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-propan-2-ylguanidine (PubChem CID 111126538) has the molecular formula C15H26N4S and a molecular weight of 294.47 g/mol. Its IUPAC name is 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-propan-2-ylguanidine.
| Compound Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-propan-2-ylguanidine |
|---|---|
| PubChem CID | 111126538 |
| Molecular Formula | C15H26N4S |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-propan-2-ylguanidine |
| SMILES | C/N=C(/NCC(C)N1CCc2sccc2C1)NC(C)C |
| InChI | InChI=1S/C15H26N4S/c1-11(2)18-15(16-4)17-9-12(3)19-7-5-14-13(10-19)6-8-20-14/h6,8,11-12H,5,7,9-10H2,1-4H3,(H2,16,17,18) |
| InChIKey | XUHXDJSCKGCJAT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|