C17H25N5S2 — CID 111523774
1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 111523774) has the molecular formula C17H25N5S2 and a molecular weight of 363.56 g/mol. Its IUPAC name is 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111523774 |
| Molecular Formula | C17H25N5S2 |
| Molecular Weight | 363.56 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ncc(C)s1)NCC(C)N1CCc2sccc2C1 |
| InChI | InChI=1S/C17H25N5S2/c1-12(22-6-4-15-14(11-22)5-7-23-15)8-20-17(18-3)21-10-16-19-9-13(2)24-16/h5,7,9,12H,4,6,8,10-11H2,1-3H3,(H2,18,20,21) |
| InChIKey | ABWLGMWOAWTJQT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.56 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|