C18H30N4S2 — CID 111529365
1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine (PubChem CID 111529365) has the molecular formula C18H30N4S2 and a molecular weight of 366.60 g/mol. Its IUPAC name is 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine.
| Compound Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine |
|---|---|
| PubChem CID | 111529365 |
| Molecular Formula | C18H30N4S2 |
| Molecular Weight | 366.60 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine |
| SMILES | C/N=C(\NCC(C)N1CCc2sccc2C1)NC1CCC(SC)C1 |
| InChI | InChI=1S/C18H30N4S2/c1-13(22-8-6-17-14(12-22)7-9-24-17)11-20-18(19-2)21-15-4-5-16(10-15)23-3/h7,9,13,15-16H,4-6,8,10-12H2,1-3H3,(H2,19,20,21) |
| InChIKey | TYGNNIWPCPGEAQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.60 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|