C23H30N6S — CID 111849499
1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111849499) has the molecular formula C23H30N6S and a molecular weight of 422.60 g/mol. Its IUPAC name is 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111849499 |
| Molecular Formula | C23H30N6S |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccccc1Cn1cccn1)NCC(C)N1CCc2sccc2C1 |
| InChI | InChI=1S/C23H30N6S/c1-18(28-12-8-22-21(16-28)9-13-30-22)14-25-23(24-2)26-15-19-6-3-4-7-20(19)17-29-11-5-10-27-29/h3-7,9-11,13,18H,8,12,14-17H2,1-2H3,(H2,24,25,26) |
| InChIKey | IRQKNXCVCAQYJQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|