C23H29IN6OS — CID 111852105
1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111852105) has the molecular formula C23H29IN6OS and a molecular weight of 564.50 g/mol. Its IUPAC name is 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111852105 |
| Molecular Formula | C23H29IN6OS |
| Molecular Weight | 564.50 g/mol |
| Exact Mass | 564.12 |
| IUPAC Name | 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCC(=O)N1CCc2sccc2C1)NCc1ccccc1Cn1cccn1.I |
| InChI | InChI=1S/C23H28N6OS.HI/c1-24-23(25-11-7-22(30)28-13-8-21-20(16-28)9-14-31-21)26-15-18-5-2-3-6-19(18)17-29-12-4-10-27-29;/h2-6,9-10,12,14H,7-8,11,13,15-17H2,1H3,(H2,24,25,26);1H |
| InChIKey | JOVGPVNSONAGRI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|