C20H26N4OS2 — CID 111373489
1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methyl-3-(2-phenylsulfanylethyl)guanidine (PubChem CID 111373489) has the molecular formula C20H26N4OS2 and a molecular weight of 402.59 g/mol. Its IUPAC name is 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methyl-3-(2-phenylsulfanylethyl)guanidine.
| Compound Name | 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methyl-3-(2-phenylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111373489 |
| Molecular Formula | C20H26N4OS2 |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methyl-3-(2-phenylsulfanylethyl)guanidine |
| SMILES | C/N=C(\NCCSc1ccccc1)NCCC(=O)N1CCc2sccc2C1 |
| InChI | InChI=1S/C20H26N4OS2/c1-21-20(23-11-14-26-17-5-3-2-4-6-17)22-10-7-19(25)24-12-8-18-16(15-24)9-13-27-18/h2-6,9,13H,7-8,10-12,14-15H2,1H3,(H2,21,22,23) |
| InChIKey | OSOSYULBDDASOJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|