C17H28N4O2S — CID 111606423
1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-3-(2-methoxy-2-methylpropyl)-2-methylguanidine (PubChem CID 111606423) has the molecular formula C17H28N4O2S and a molecular weight of 352.50 g/mol. Its IUPAC name is 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-3-(2-methoxy-2-methylpropyl)-2-methylguanidine.
| Compound Name | 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-3-(2-methoxy-2-methylpropyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111606423 |
| Molecular Formula | C17H28N4O2S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-3-(2-methoxy-2-methylpropyl)-2-methylguanidine |
| SMILES | C/N=C(/NCCC(=O)N1CCc2sccc2C1)NCC(C)(C)OC |
| InChI | InChI=1S/C17H28N4O2S/c1-17(2,23-4)12-20-16(18-3)19-8-5-15(22)21-9-6-14-13(11-21)7-10-24-14/h7,10H,5-6,8-9,11-12H2,1-4H3,(H2,18,19,20) |
| InChIKey | VGGSRYTXGHBHII-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|