C19H23FN4OS — CID 111231015
1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-3-[(4-fluorophenyl)methyl]-2-methylguanidine (PubChem CID 111231015) has the molecular formula C19H23FN4OS and a molecular weight of 374.49 g/mol. Its IUPAC name is 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-3-[(4-fluorophenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-3-[(4-fluorophenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111231015 |
| Molecular Formula | C19H23FN4OS |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-3-[(4-fluorophenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCC(=O)N1CCc2sccc2C1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H23FN4OS/c1-21-19(23-12-14-2-4-16(20)5-3-14)22-9-6-18(25)24-10-7-17-15(13-24)8-11-26-17/h2-5,8,11H,6-7,9-10,12-13H2,1H3,(H2,21,22,23) |
| InChIKey | KBWXLGYWOPKSQV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|