C19H25IN4OS — CID 110953409
1-benzyl-3-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methylguanidine;hydroiodide (PubChem CID 110953409) has the molecular formula C19H25IN4OS and a molecular weight of 484.41 g/mol. Its IUPAC name is 1-benzyl-3-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-benzyl-3-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110953409 |
| Molecular Formula | C19H25IN4OS |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | 1-benzyl-3-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCC(=O)N1CCc2sccc2C1)NCc1ccccc1.I |
| InChI | InChI=1S/C19H24N4OS.HI/c1-20-19(22-13-15-5-3-2-4-6-15)21-10-7-18(24)23-11-8-17-16(14-23)9-12-25-17;/h2-6,9,12H,7-8,10-11,13-14H2,1H3,(H2,20,21,22);1H |
| InChIKey | XMAXEJZIFWBNIL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|