C19H27IN4OS2 — CID 111703985
1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide (PubChem CID 111703985) has the molecular formula C19H27IN4OS2 and a molecular weight of 518.49 g/mol. Its IUPAC name is 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111703985 |
| Molecular Formula | C19H27IN4OS2 |
| Molecular Weight | 518.49 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCC(=O)N1CCc2sccc2C1)NCC(C)c1ccsc1.I |
| InChI | InChI=1S/C19H26N4OS2.HI/c1-14(16-5-9-25-13-16)11-22-19(20-2)21-7-3-18(24)23-8-4-17-15(12-23)6-10-26-17;/h5-6,9-10,13-14H,3-4,7-8,11-12H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | SQZNQEPVULYTEO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|