C23H30IN5OS — CID 111341870
1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine;hydroiodide (PubChem CID 111341870) has the molecular formula C23H30IN5OS and a molecular weight of 551.50 g/mol. Its IUPAC name is 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111341870 |
| Molecular Formula | C23H30IN5OS |
| Molecular Weight | 551.50 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCn1ccc2ccccc21)NCCC(=O)N1CCc2sccc2C1.I |
| InChI | InChI=1S/C23H29N5OS.HI/c1-24-23(25-11-4-13-27-14-8-18-5-2-3-6-20(18)27)26-12-7-22(29)28-15-9-21-19(17-28)10-16-30-21;/h2-3,5-6,8,10,14,16H,4,7,9,11-13,15,17H2,1H3,(H2,24,25,26);1H |
| InChIKey | KABWLDKUZHMQQU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|