C23H31IN6OS — CID 111352865
1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111352865) has the molecular formula C23H31IN6OS and a molecular weight of 566.51 g/mol. Its IUPAC name is 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111352865 |
| Molecular Formula | C23H31IN6OS |
| Molecular Weight | 566.51 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCn1c(C)nc2ccccc21)NCCC(=O)N1CCc2sccc2C1.I |
| InChI | InChI=1S/C23H30N6OS.HI/c1-17-27-19-6-3-4-7-20(19)29(17)13-5-11-25-23(24-2)26-12-8-22(30)28-14-9-21-18(16-28)10-15-31-21;/h3-4,6-7,10,15H,5,8-9,11-14,16H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | ZVLDWXFIAWDIPE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|