C20H31N5O2 — CID 111352368
methyl 6-[[N'-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]carbamimidoyl]amino]hexanoate (PubChem CID 111352368) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is methyl 6-[[N'-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]carbamimidoyl]amino]hexanoate.
| Compound Name | methyl 6-[[N'-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]carbamimidoyl]amino]hexanoate |
|---|---|
| PubChem CID | 111352368 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | methyl 6-[[N'-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]carbamimidoyl]amino]hexanoate |
| SMILES | C/N=C(\NCCCCCC(=O)OC)NCCCn1c(C)nc2ccccc21 |
| InChI | InChI=1S/C20H31N5O2/c1-16-24-17-10-6-7-11-18(17)25(16)15-9-14-23-20(21-2)22-13-8-4-5-12-19(26)27-3/h6-7,10-11H,4-5,8-9,12-15H2,1-3H3,(H2,21,22,23) |
| InChIKey | GYUODZUHDOURIJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|