C21H28N6O2S — CID 111351730
1-[2-(benzenesulfonamido)ethyl]-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine (PubChem CID 111351730) has the molecular formula C21H28N6O2S and a molecular weight of 428.56 g/mol. Its IUPAC name is 1-[2-(benzenesulfonamido)ethyl]-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine.
| Compound Name | 1-[2-(benzenesulfonamido)ethyl]-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111351730 |
| Molecular Formula | C21H28N6O2S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 1-[2-(benzenesulfonamido)ethyl]-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCCn1c(C)nc2ccccc21)NCCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H28N6O2S/c1-17-26-19-11-6-7-12-20(19)27(17)16-8-13-23-21(22-2)24-14-15-25-30(28,29)18-9-4-3-5-10-18/h3-7,9-12,25H,8,13-16H2,1-2H3,(H2,22,23,24) |
| InChIKey | LJMNDTNZBQFQNV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|