C22H31IN6O2S — CID 111352825
1-[[4-(dimethylsulfamoyl)phenyl]methyl]-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111352825) has the molecular formula C22H31IN6O2S and a molecular weight of 570.50 g/mol. Its IUPAC name is 1-[[4-(dimethylsulfamoyl)phenyl]methyl]-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[[4-(dimethylsulfamoyl)phenyl]methyl]-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111352825 |
| Molecular Formula | C22H31IN6O2S |
| Molecular Weight | 570.50 g/mol |
| Exact Mass | 570.13 |
| IUPAC Name | 1-[[4-(dimethylsulfamoyl)phenyl]methyl]-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCn1c(C)nc2ccccc21)NCc1ccc(S(=O)(=O)N(C)C)cc1.I |
| InChI | InChI=1S/C22H30N6O2S.HI/c1-17-26-20-8-5-6-9-21(20)28(17)15-7-14-24-22(23-2)25-16-18-10-12-19(13-11-18)31(29,30)27(3)4;/h5-6,8-13H,7,14-16H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | GMIGHQRXQWMUKB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|