C24H33N7O — CID 111353234
1-[4-[[[N'-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]carbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea (PubChem CID 111353234) has the molecular formula C24H33N7O and a molecular weight of 435.58 g/mol. Its IUPAC name is 1-[4-[[[N'-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]carbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-[[[N'-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]carbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 111353234 |
| Molecular Formula | C24H33N7O |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | 1-[4-[[[N'-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]carbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea |
| SMILES | C/N=C(/NCCCn1c(C)nc2ccccc21)NCc1ccc(NC(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C24H33N7O/c1-17(2)28-24(32)30-20-12-10-19(11-13-20)16-27-23(25-4)26-14-7-15-31-18(3)29-21-8-5-6-9-22(21)31/h5-6,8-13,17H,7,14-16H2,1-4H3,(H2,25,26,27)(H2,28,30,32) |
| InChIKey | NBZAEUCKWMVCAZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 95.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|