C19H27N7 — CID 111352474
1-(3-imidazol-1-ylpropyl)-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine (PubChem CID 111352474) has the molecular formula C19H27N7 and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111352474 |
| Molecular Formula | C19H27N7 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine |
| SMILES | C/N=C(\NCCCn1ccnc1)NCCCn1c(C)nc2ccccc21 |
| InChI | InChI=1S/C19H27N7/c1-16-24-17-7-3-4-8-18(17)26(16)13-6-10-23-19(20-2)22-9-5-12-25-14-11-21-15-25/h3-4,7-8,11,14-15H,5-6,9-10,12-13H2,1-2H3,(H2,20,22,23) |
| InChIKey | CKVBUZJKLSKXGU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|