C24H30IN5O — CID 111341880
1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine;hydroiodide (PubChem CID 111341880) has the molecular formula C24H30IN5O and a molecular weight of 531.44 g/mol. Its IUPAC name is 1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111341880 |
| Molecular Formula | C24H30IN5O |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCn1ccc2ccccc21)NCC(=O)N1CCc2ccccc2C1.I |
| InChI | InChI=1S/C24H29N5O.HI/c1-25-24(26-13-6-14-28-15-12-20-8-4-5-10-22(20)28)27-17-23(30)29-16-11-19-7-2-3-9-21(19)18-29;/h2-5,7-10,12,15H,6,11,13-14,16-18H2,1H3,(H2,25,26,27);1H |
| InChIKey | WKCNQQVRSFONPU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|