C25H31IN6O — CID 111558688
1-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111558688) has the molecular formula C25H31IN6O and a molecular weight of 558.47 g/mol. Its IUPAC name is 1-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111558688 |
| Molecular Formula | C25H31IN6O |
| Molecular Weight | 558.47 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | 1-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCC(=O)N1Cc2ccccc2C1)NCc1ccccc1Cn1cccn1.I |
| InChI | InChI=1S/C25H30N6O.HI/c1-26-25(28-16-20-8-2-3-11-23(20)19-31-15-7-14-29-31)27-13-6-12-24(32)30-17-21-9-4-5-10-22(21)18-30;/h2-5,7-11,14-15H,6,12-13,16-19H2,1H3,(H2,26,27,28);1H |
| InChIKey | FXESXDCCKDMHFA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|