C22H33N5O2 — CID 111851334
ethyl 7-[[N'-methyl-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]heptanoate (PubChem CID 111851334) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is ethyl 7-[[N'-methyl-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]heptanoate.
| Compound Name | ethyl 7-[[N'-methyl-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]heptanoate |
|---|---|
| PubChem CID | 111851334 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | ethyl 7-[[N'-methyl-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]heptanoate |
| SMILES | CCOC(=O)CCCCCCN/C(=N\C)NCc1ccccc1Cn1cccn1 |
| InChI | InChI=1S/C22H33N5O2/c1-3-29-21(28)13-6-4-5-9-14-24-22(23-2)25-17-19-11-7-8-12-20(19)18-27-16-10-15-26-27/h7-8,10-12,15-16H,3-6,9,13-14,17-18H2,1-2H3,(H2,23,24,25) |
| InChIKey | XOEXFQCJPJPSST-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|