C23H36IN5O2 — CID 111851225
ethyl 7-[[N-ethyl-N'-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]heptanoate;hydroiodide (PubChem CID 111851225) has the molecular formula C23H36IN5O2 and a molecular weight of 541.48 g/mol. Its IUPAC name is ethyl 7-[[N-ethyl-N'-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]heptanoate;hydroiodide.
| Compound Name | ethyl 7-[[N-ethyl-N'-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]heptanoate;hydroiodide |
|---|---|
| PubChem CID | 111851225 |
| Molecular Formula | C23H36IN5O2 |
| Molecular Weight | 541.48 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | ethyl 7-[[N-ethyl-N'-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]heptanoate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1Cn1cccn1)NCCCCCCC(=O)OCC.I |
| InChI | InChI=1S/C23H35N5O2.HI/c1-3-24-23(25-15-10-6-5-7-14-22(29)30-4-2)26-18-20-12-8-9-13-21(20)19-28-17-11-16-27-28;/h8-9,11-13,16-17H,3-7,10,14-15,18-19H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | XHQJWPYEOPXULX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|