C24H36IN5OS — CID 111283560
1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111283560) has the molecular formula C24H36IN5OS and a molecular weight of 569.56 g/mol. Its IUPAC name is 1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111283560 |
| Molecular Formula | C24H36IN5OS |
| Molecular Weight | 569.56 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | 1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCC(C)N1CCc2ccccc2C1)NCC(c1cccs1)N1CCOCC1.I |
| InChI | InChI=1S/C24H35N5OS.HI/c1-19(29-10-9-20-6-3-4-7-21(20)18-29)16-26-24(25-2)27-17-22(23-8-5-15-31-23)28-11-13-30-14-12-28;/h3-8,15,19,22H,9-14,16-18H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | ONRHANMIQQJKKX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.56 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|