C22H31IN4O2S2 — CID 111143099
2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide (PubChem CID 111143099) has the molecular formula C22H31IN4O2S2 and a molecular weight of 574.55 g/mol. Its IUPAC name is 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111143099 |
| Molecular Formula | C22H31IN4O2S2 |
| Molecular Weight | 574.55 g/mol |
| Exact Mass | 574.09 |
| IUPAC Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccccc1)N1CCc2sccc2C1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C22H30N4O2S2.HI/c1-2-23-22(25-19-10-13-30(27,28)16-19)24-14-20(17-6-4-3-5-7-17)26-11-8-21-18(15-26)9-12-29-21;/h3-7,9,12,19-20H,2,8,10-11,13-16H2,1H3,(H2,23,24,25);1H |
| InChIKey | LFXPEHAXXURXHW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|