C19H30ClIN4O3S — CID 111143681
2-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide (PubChem CID 111143681) has the molecular formula C19H30ClIN4O3S and a molecular weight of 556.90 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111143681 |
| Molecular Formula | C19H30ClIN4O3S |
| Molecular Weight | 556.90 g/mol |
| Exact Mass | 556.08 |
| IUPAC Name | 2-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1cccc(Cl)c1)N1CCOCC1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C19H29ClN4O3S.HI/c1-2-21-19(23-17-6-11-28(25,26)14-17)22-13-18(24-7-9-27-10-8-24)15-4-3-5-16(20)12-15;/h3-5,12,17-18H,2,6-11,13-14H2,1H3,(H2,21,22,23);1H |
| InChIKey | YAFIZUMTCGAVFZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.90 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|