C18H30N4O3S2 — CID 111966065
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine (PubChem CID 111966065) has the molecular formula C18H30N4O3S2 and a molecular weight of 414.60 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine |
|---|---|
| PubChem CID | 111966065 |
| Molecular Formula | C18H30N4O3S2 |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine |
| SMILES | CCN/C(=N\CC(c1ccc(C)s1)N1CCOCC1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H30N4O3S2/c1-3-19-18(21-15-6-11-27(23,24)13-15)20-12-16(17-5-4-14(2)26-17)22-7-9-25-10-8-22/h4-5,15-16H,3,6-13H2,1-2H3,(H2,19,20,21) |
| InChIKey | VEVSYGZNDNTJGU-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|