C19H29ClN4O3S — CID 111142797
2-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine (PubChem CID 111142797) has the molecular formula C19H29ClN4O3S and a molecular weight of 428.99 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine.
| Compound Name | 2-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111142797 |
| Molecular Formula | C19H29ClN4O3S |
| Molecular Weight | 428.99 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(c1ccc(Cl)cc1)N1CCOCC1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H29ClN4O3S/c1-2-21-19(23-17-7-12-28(25,26)14-17)22-13-18(24-8-10-27-11-9-24)15-3-5-16(20)6-4-15/h3-6,17-18H,2,7-14H2,1H3,(H2,21,22,23) |
| InChIKey | FSNYNJWKOFWNFM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.99 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|