C21H34N4O2S — CID 111142855
2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-3-methylbutyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine (PubChem CID 111142855) has the molecular formula C21H34N4O2S and a molecular weight of 406.60 g/mol. Its IUPAC name is 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-3-methylbutyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine.
| Compound Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-3-methylbutyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111142855 |
| Molecular Formula | C21H34N4O2S |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-3-methylbutyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(C(C)C)N1CCc2ccccc2C1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H34N4O2S/c1-4-22-21(24-19-10-12-28(26,27)15-19)23-13-20(16(2)3)25-11-9-17-7-5-6-8-18(17)14-25/h5-8,16,19-20H,4,9-15H2,1-3H3,(H2,22,23,24) |
| InChIKey | VAXCIIHEVGQQCS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|