C16H24IN3O2S — CID 111142768
2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide (PubChem CID 111142768) has the molecular formula C16H24IN3O2S and a molecular weight of 449.36 g/mol. Its IUPAC name is 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111142768 |
| Molecular Formula | C16H24IN3O2S |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1Cc2ccccc21)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C16H23N3O2S.HI/c1-2-17-16(19-14-7-8-22(20,21)11-14)18-10-13-9-12-5-3-4-6-15(12)13;/h3-6,13-14H,2,7-11H2,1H3,(H2,17,18,19);1H |
| InChIKey | GWDIABGZXKYHTO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|