C16H25IN4O4S — CID 111142070
N-[2-[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]ethyl]-2-hydroxybenzamide;hydroiodide (PubChem CID 111142070) has the molecular formula C16H25IN4O4S and a molecular weight of 496.37 g/mol. Its IUPAC name is N-[2-[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]ethyl]-2-hydroxybenzamide;hydroiodide.
| Compound Name | N-[2-[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]ethyl]-2-hydroxybenzamide;hydroiodide |
|---|---|
| PubChem CID | 111142070 |
| Molecular Formula | C16H25IN4O4S |
| Molecular Weight | 496.37 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | N-[2-[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]ethyl]-2-hydroxybenzamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccccc1O)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C16H24N4O4S.HI/c1-2-17-16(20-12-7-10-25(23,24)11-12)19-9-8-18-15(22)13-5-3-4-6-14(13)21;/h3-6,12,21H,2,7-11H2,1H3,(H,18,22)(H2,17,19,20);1H |
| InChIKey | DEJDFVQVBUKMCA-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 119.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.37 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|