C15H24IN5O4S — CID 111141038
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(2-nitroanilino)ethyl]guanidine;hydroiodide (PubChem CID 111141038) has the molecular formula C15H24IN5O4S and a molecular weight of 497.36 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(2-nitroanilino)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(2-nitroanilino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111141038 |
| Molecular Formula | C15H24IN5O4S |
| Molecular Weight | 497.36 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(2-nitroanilino)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCNc1ccccc1[N+](=O)[O-])NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C15H23N5O4S.HI/c1-2-16-15(19-12-7-10-25(23,24)11-12)18-9-8-17-13-5-3-4-6-14(13)20(21)22;/h3-6,12,17H,2,7-11H2,1H3,(H2,16,18,19);1H |
| InChIKey | OGOOZXSNOPOYIA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 125.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|