C15H23N5O6S2 — CID 111141007
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine (PubChem CID 111141007) has the molecular formula C15H23N5O6S2 and a molecular weight of 433.51 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine |
|---|---|
| PubChem CID | 111141007 |
| Molecular Formula | C15H23N5O6S2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine |
| SMILES | CCN/C(=N\CCNS(=O)(=O)c1cccc([N+](=O)[O-])c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H23N5O6S2/c1-2-16-15(19-12-6-9-27(23,24)11-12)17-7-8-18-28(25,26)14-5-3-4-13(10-14)20(21)22/h3-5,10,12,18H,2,6-9,11H2,1H3,(H2,16,17,19) |
| InChIKey | VLRHTRLFRCYABL-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 159.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|