C17H28IN5O4S — CID 110957515
1-cyclohexyl-3-ethyl-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine;hydroiodide (PubChem CID 110957515) has the molecular formula C17H28IN5O4S and a molecular weight of 525.41 g/mol. Its IUPAC name is 1-cyclohexyl-3-ethyl-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-cyclohexyl-3-ethyl-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110957515 |
| Molecular Formula | C17H28IN5O4S |
| Molecular Weight | 525.41 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | 1-cyclohexyl-3-ethyl-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCNS(=O)(=O)c1cccc([N+](=O)[O-])c1)NC1CCCCC1.I |
| InChI | InChI=1S/C17H27N5O4S.HI/c1-2-18-17(21-14-7-4-3-5-8-14)19-11-12-20-27(25,26)16-10-6-9-15(13-16)22(23)24;/h6,9-10,13-14,20H,2-5,7-8,11-12H2,1H3,(H2,18,19,21);1H |
| InChIKey | CQZLJUMFUYNNBC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 125.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|