C19H34N6O4S — CID 111247241
1-[2-[di(propan-2-yl)amino]ethyl]-3-ethyl-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine (PubChem CID 111247241) has the molecular formula C19H34N6O4S and a molecular weight of 442.59 g/mol. Its IUPAC name is 1-[2-[di(propan-2-yl)amino]ethyl]-3-ethyl-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine.
| Compound Name | 1-[2-[di(propan-2-yl)amino]ethyl]-3-ethyl-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine |
|---|---|
| PubChem CID | 111247241 |
| Molecular Formula | C19H34N6O4S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 1-[2-[di(propan-2-yl)amino]ethyl]-3-ethyl-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine |
| SMILES | CCN/C(=N\CCNS(=O)(=O)c1cccc([N+](=O)[O-])c1)NCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C19H34N6O4S/c1-6-20-19(22-12-13-24(15(2)3)16(4)5)21-10-11-23-30(28,29)18-9-7-8-17(14-18)25(26)27/h7-9,14-16,23H,6,10-13H2,1-5H3,(H2,20,21,22) |
| InChIKey | CJFOHBHWPMNFOE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|