C15H25N5O5S — CID 110974113
1-ethyl-2-(3-methoxypropyl)-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine (PubChem CID 110974113) has the molecular formula C15H25N5O5S and a molecular weight of 387.46 g/mol. Its IUPAC name is 1-ethyl-2-(3-methoxypropyl)-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine.
| Compound Name | 1-ethyl-2-(3-methoxypropyl)-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine |
|---|---|
| PubChem CID | 110974113 |
| Molecular Formula | C15H25N5O5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 1-ethyl-2-(3-methoxypropyl)-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine |
| SMILES | CCN/C(=N\CCCOC)NCCNS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H25N5O5S/c1-3-16-15(17-8-5-11-25-2)18-9-10-19-26(23,24)14-7-4-6-13(12-14)20(21)22/h4,6-7,12,19H,3,5,8-11H2,1-2H3,(H2,16,17,18) |
| InChIKey | YMCKYSHJOKTUDQ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|