C19H25FIN5O4S — CID 111854223
1-ethyl-2-[(4-fluoro-3-methylphenyl)methyl]-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine;hydroiodide (PubChem CID 111854223) has the molecular formula C19H25FIN5O4S and a molecular weight of 565.41 g/mol. Its IUPAC name is 1-ethyl-2-[(4-fluoro-3-methylphenyl)methyl]-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(4-fluoro-3-methylphenyl)methyl]-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111854223 |
| Molecular Formula | C19H25FIN5O4S |
| Molecular Weight | 565.41 g/mol |
| Exact Mass | 565.07 |
| IUPAC Name | 1-ethyl-2-[(4-fluoro-3-methylphenyl)methyl]-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)c(C)c1)NCCNS(=O)(=O)c1cccc([N+](=O)[O-])c1.I |
| InChI | InChI=1S/C19H24FN5O4S.HI/c1-3-21-19(23-13-15-7-8-18(20)14(2)11-15)22-9-10-24-30(28,29)17-6-4-5-16(12-17)25(26)27;/h4-8,11-12,24H,3,9-10,13H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | DFTRIEGPBZEJQB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 125.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|