C17H29N5O6S — CID 111404711
1-ethyl-2-[3-(2-methoxyethoxy)propyl]-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine (PubChem CID 111404711) has the molecular formula C17H29N5O6S and a molecular weight of 431.52 g/mol. Its IUPAC name is 1-ethyl-2-[3-(2-methoxyethoxy)propyl]-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine.
| Compound Name | 1-ethyl-2-[3-(2-methoxyethoxy)propyl]-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine |
|---|---|
| PubChem CID | 111404711 |
| Molecular Formula | C17H29N5O6S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 1-ethyl-2-[3-(2-methoxyethoxy)propyl]-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine |
| SMILES | CCN/C(=N\CCCOCCOC)NCCNS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H29N5O6S/c1-3-18-17(19-8-5-11-28-13-12-27-2)20-9-10-21-29(25,26)16-7-4-6-15(14-16)22(23)24/h4,6-7,14,21H,3,5,8-13H2,1-2H3,(H2,18,19,20) |
| InChIKey | XAWMJFPMDXIGNE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 144.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|