C15H24IN5O4S — CID 111961266
1-ethyl-3-(2-methylcyclopropyl)-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine;hydroiodide (PubChem CID 111961266) has the molecular formula C15H24IN5O4S and a molecular weight of 497.36 g/mol. Its IUPAC name is 1-ethyl-3-(2-methylcyclopropyl)-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-methylcyclopropyl)-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111961266 |
| Molecular Formula | C15H24IN5O4S |
| Molecular Weight | 497.36 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | 1-ethyl-3-(2-methylcyclopropyl)-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCNS(=O)(=O)c1cccc([N+](=O)[O-])c1)NC1CC1C.I |
| InChI | InChI=1S/C15H23N5O4S.HI/c1-3-16-15(19-14-9-11(14)2)17-7-8-18-25(23,24)13-6-4-5-12(10-13)20(21)22;/h4-6,10-11,14,18H,3,7-9H2,1-2H3,(H2,16,17,19);1H |
| InChIKey | QKICHFCVVVKDHH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 125.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|