C19H29N5O4S — CID 109443147
N-ethyl-N'-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide (PubChem CID 109443147) has the molecular formula C19H29N5O4S and a molecular weight of 423.54 g/mol. Its IUPAC name is N-ethyl-N'-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide.
| Compound Name | N-ethyl-N'-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 109443147 |
| Molecular Formula | C19H29N5O4S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | N-ethyl-N'-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
| SMILES | CCN/C(=N\CCNS(=O)(=O)c1cccc([N+](=O)[O-])c1)N1CC2CCCCC2C1 |
| InChI | InChI=1S/C19H29N5O4S/c1-2-20-19(23-13-15-6-3-4-7-16(15)14-23)21-10-11-22-29(27,28)18-9-5-8-17(12-18)24(25)26/h5,8-9,12,15-16,22H,2-4,6-7,10-11,13-14H2,1H3,(H,20,21) |
| InChIKey | OKXLXKKNBVBUJM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|