C15H24IN5O4S — CID 110920557
4-methyl-N'-[2-[(3-nitrophenyl)sulfonylamino]ethyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 110920557) has the molecular formula C15H24IN5O4S and a molecular weight of 497.36 g/mol. Its IUPAC name is 4-methyl-N'-[2-[(3-nitrophenyl)sulfonylamino]ethyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-methyl-N'-[2-[(3-nitrophenyl)sulfonylamino]ethyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110920557 |
| Molecular Formula | C15H24IN5O4S |
| Molecular Weight | 497.36 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | 4-methyl-N'-[2-[(3-nitrophenyl)sulfonylamino]ethyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CC1CCN(/C(N)=N/CCNS(=O)(=O)c2cccc([N+](=O)[O-])c2)CC1.I |
| InChI | InChI=1S/C15H23N5O4S.HI/c1-12-5-9-19(10-6-12)15(16)17-7-8-18-25(23,24)14-4-2-3-13(11-14)20(21)22;/h2-4,11-12,18H,5-10H2,1H3,(H2,16,17);1H |
| InChIKey | UVTOLSBJSXLPQI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 130.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|