C17H29N5O4S — CID 111085241
1-(6-methylheptan-2-yl)-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine (PubChem CID 111085241) has the molecular formula C17H29N5O4S and a molecular weight of 399.52 g/mol. Its IUPAC name is 1-(6-methylheptan-2-yl)-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine.
| Compound Name | 1-(6-methylheptan-2-yl)-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine |
|---|---|
| PubChem CID | 111085241 |
| Molecular Formula | C17H29N5O4S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 1-(6-methylheptan-2-yl)-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine |
| SMILES | CC(C)CCCC(C)N/C(N)=N/CCNS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H29N5O4S/c1-13(2)6-4-7-14(3)21-17(18)19-10-11-20-27(25,26)16-9-5-8-15(12-16)22(23)24/h5,8-9,12-14,20H,4,6-7,10-11H2,1-3H3,(H3,18,19,21) |
| InChIKey | KHMLKYRILNGKKQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|