C16H27IN4O2S — CID 110920727
4-methyl-N'-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 110920727) has the molecular formula C16H27IN4O2S and a molecular weight of 466.39 g/mol. Its IUPAC name is 4-methyl-N'-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-methyl-N'-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110920727 |
| Molecular Formula | C16H27IN4O2S |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 4-methyl-N'-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | Cc1ccc(S(=O)(=O)NCC/N=C(\N)N2CCC(C)CC2)cc1.I |
| InChI | InChI=1S/C16H26N4O2S.HI/c1-13-3-5-15(6-4-13)23(21,22)19-10-9-18-16(17)20-11-7-14(2)8-12-20;/h3-6,14,19H,7-12H2,1-2H3,(H2,17,18);1H |
| InChIKey | VJIJYAKUKXODRJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|