C18H31IN4O2S — CID 111210564
N-ethyl-4-methyl-N'-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111210564) has the molecular formula C18H31IN4O2S and a molecular weight of 494.44 g/mol. Its IUPAC name is N-ethyl-4-methyl-N'-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-methyl-N'-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111210564 |
| Molecular Formula | C18H31IN4O2S |
| Molecular Weight | 494.44 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | N-ethyl-4-methyl-N'-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCNS(=O)(=O)c1ccc(C)cc1)N1CCC(C)CC1.I |
| InChI | InChI=1S/C18H30N4O2S.HI/c1-4-19-18(22-13-9-16(3)10-14-22)20-11-12-21-25(23,24)17-7-5-15(2)6-8-17;/h5-8,16,21H,4,9-14H2,1-3H3,(H,19,20);1H |
| InChIKey | GKWZJEKENRTTMV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|