C18H30IN3O2S — CID 111210234
N'-[3-(benzenesulfonyl)propyl]-N-ethyl-4-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111210234) has the molecular formula C18H30IN3O2S and a molecular weight of 479.43 g/mol. Its IUPAC name is N'-[3-(benzenesulfonyl)propyl]-N-ethyl-4-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[3-(benzenesulfonyl)propyl]-N-ethyl-4-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111210234 |
| Molecular Formula | C18H30IN3O2S |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | N'-[3-(benzenesulfonyl)propyl]-N-ethyl-4-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCS(=O)(=O)c1ccccc1)N1CCC(C)CC1.I |
| InChI | InChI=1S/C18H29N3O2S.HI/c1-3-19-18(21-13-10-16(2)11-14-21)20-12-7-15-24(22,23)17-8-5-4-6-9-17;/h4-6,8-9,16H,3,7,10-15H2,1-2H3,(H,19,20);1H |
| InChIKey | NYRNKOKVSPCSTR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|